C22H27N3O3S — CID 4069356
3-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carbonyl)-N,N-dimethylbenzenesulfonamide (PubChem CID 4069356) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is 3-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carbonyl)-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carbonyl)-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 4069356 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 3-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carbonyl)-N,N-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc2c(c1)C1CN(C)CCC1N2C(=O)c1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C22H27N3O3S/c1-15-8-9-20-18(12-15)19-14-24(4)11-10-21(19)25(20)22(26)16-6-5-7-17(13-16)29(27,28)23(2)3/h5-9,12-13,19,21H,10-11,14H2,1-4H3 |
| InChIKey | ZOPZNBBJXXJODP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |