C18H21N2O2+ — CID 6596221
[(4aS,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-yl]-(furan-2-yl)methanone (PubChem CID 6596221) has the molecular formula C18H21N2O2+ and a molecular weight of 297.38 g/mol. Its IUPAC name is [(4aS,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-yl]-(furan-2-yl)methanone.
| Compound Name | [(4aS,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 6596221 |
| Molecular Formula | C18H21N2O2+ |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | [(4aS,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-yl]-(furan-2-yl)methanone |
| SMILES | Cc1ccc2c(c1)[C@H]1C[NH+](C)CC[C@@H]1N2C(=O)c1ccco1 |
| InChI | InChI=1S/C18H20N2O2/c1-12-5-6-15-13(10-12)14-11-19(2)8-7-16(14)20(15)18(21)17-4-3-9-22-17/h3-6,9-10,14,16H,7-8,11H2,1-2H3/p+1/t14-,16+/m1/s1 |
| InChIKey | UZXWVNVUOFWQOO-ZBFHGGJFSA-O |
| XLogP | 1.62 |
| TPSA | 37.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |