C18H19BrN2O2 — CID 51398841
[(4aS,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-(5-bromofuran-2-yl)methanone (PubChem CID 51398841) has the molecular formula C18H19BrN2O2 and a molecular weight of 375.27 g/mol. Its IUPAC name is [(4aS,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-(5-bromofuran-2-yl)methanone.
| Compound Name | [(4aS,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-(5-bromofuran-2-yl)methanone |
|---|---|
| PubChem CID | 51398841 |
| Molecular Formula | C18H19BrN2O2 |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | [(4aS,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-(5-bromofuran-2-yl)methanone |
| SMILES | Cc1ccc2c(c1)[C@H]1CN(C)CC[C@@H]1N2C(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C18H19BrN2O2/c1-11-3-4-14-12(9-11)13-10-20(2)8-7-15(13)21(14)18(22)16-5-6-17(19)23-16/h3-6,9,13,15H,7-8,10H2,1-2H3/t13-,15+/m1/s1 |
| InChIKey | BOLRZMFCMDFVNA-HIFRSBDPSA-N |
| XLogP | 3.80 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |