C30H35N3O5S — CID 92535115
N-[4-[2-[(4aR,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-2-oxoethoxy]phenyl]-4-ethoxy-N-methylbenzenesulfonamide (PubChem CID 92535115) has the molecular formula C30H35N3O5S and a molecular weight of 549.69 g/mol. Its IUPAC name is N-[4-[2-[(4aR,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-2-oxoethoxy]phenyl]-4-ethoxy-N-methylbenzenesulfonamide.
| Compound Name | N-[4-[2-[(4aR,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-2-oxoethoxy]phenyl]-4-ethoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 92535115 |
| Molecular Formula | C30H35N3O5S |
| Molecular Weight | 549.69 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | N-[4-[2-[(4aR,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-2-oxoethoxy]phenyl]-4-ethoxy-N-methylbenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(C)c2ccc(OCC(=O)N3c4ccc(C)cc4[C@H]4CN(C)CC[C@H]43)cc2)cc1 |
| InChI | InChI=1S/C30H35N3O5S/c1-5-37-23-11-13-25(14-12-23)39(35,36)32(4)22-7-9-24(10-8-22)38-20-30(34)33-28-15-6-21(2)18-26(28)27-19-31(3)17-16-29(27)33/h6-15,18,27,29H,5,16-17,19-20H2,1-4H3/t27-,29-/m1/s1 |
| InChIKey | GTPVVSLQHUGVDB-XRKRLSELSA-N |
| XLogP | 4.43 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.69 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |