C25H31N3O5S — CID 6362006
1-[(4aR,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone (PubChem CID 6362006) has the molecular formula C25H31N3O5S and a molecular weight of 485.61 g/mol. Its IUPAC name is 1-[(4aR,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone.
| Compound Name | 1-[(4aR,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone |
|---|---|
| PubChem CID | 6362006 |
| Molecular Formula | C25H31N3O5S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 1-[(4aR,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone |
| SMILES | Cc1ccc2c(c1)[C@@H]1CN(C)CC[C@H]1N2C(=O)COc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H31N3O5S/c1-18-3-8-23-21(15-18)22-16-26(2)10-9-24(22)28(23)25(29)17-33-19-4-6-20(7-5-19)34(30,31)27-11-13-32-14-12-27/h3-8,15,22,24H,9-14,16-17H2,1-2H3/t22-,24+/m0/s1 |
| InChIKey | KJDYUNZWUHTWMX-LADGPHEKSA-N |
| XLogP | 2.23 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |