C29H31N3O3 — CID 2355046
N-[4-[2-[(4aR,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-2-oxoethoxy]phenyl]-N-methylbenzamide (PubChem CID 2355046) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-[4-[2-[(4aR,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-2-oxoethoxy]phenyl]-N-methylbenzamide.
| Compound Name | N-[4-[2-[(4aR,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-2-oxoethoxy]phenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 2355046 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | N-[4-[2-[(4aR,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-2-oxoethoxy]phenyl]-N-methylbenzamide |
| SMILES | Cc1ccc2c(c1)[C@H]1CN(C)CC[C@H]1N2C(=O)COc1ccc(N(C)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H31N3O3/c1-20-9-14-26-24(17-20)25-18-30(2)16-15-27(25)32(26)28(33)19-35-23-12-10-22(11-13-23)31(3)29(34)21-7-5-4-6-8-21/h4-14,17,25,27H,15-16,18-19H2,1-3H3/t25-,27-/m1/s1 |
| InChIKey | MPZWZQXPEIPROY-XNMGPUDCSA-N |
| XLogP | 4.48 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |