C17H25N2O+ — CID 6569988
1-[(4aS,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-yl]-2-methylpropan-1-one (PubChem CID 6569988) has the molecular formula C17H25N2O+ and a molecular weight of 273.40 g/mol. Its IUPAC name is 1-[(4aS,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-yl]-2-methylpropan-1-one.
| Compound Name | 1-[(4aS,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 6569988 |
| Molecular Formula | C17H25N2O+ |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | 1-[(4aS,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-yl]-2-methylpropan-1-one |
| SMILES | Cc1ccc2c(c1)[C@H]1C[NH+](C)CC[C@@H]1N2C(=O)C(C)C |
| InChI | InChI=1S/C17H24N2O/c1-11(2)17(20)19-15-6-5-12(3)9-13(15)14-10-18(4)8-7-16(14)19/h5-6,9,11,14,16H,7-8,10H2,1-4H3/p+1/t14-,16+/m1/s1 |
| InChIKey | LSKOBBMGJQZPPY-ZBFHGGJFSA-O |
| XLogP | 1.37 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |