C22H22ClN2OS+ — CID 6595947
[(4aS,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-yl]-(3-chloro-1-benzothiophen-2-yl)methanone (PubChem CID 6595947) has the molecular formula C22H22ClN2OS+ and a molecular weight of 397.95 g/mol. Its IUPAC name is [(4aS,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-yl]-(3-chloro-1-benzothiophen-2-yl)methanone.
| Compound Name | [(4aS,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-yl]-(3-chloro-1-benzothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 6595947 |
| Molecular Formula | C22H22ClN2OS+ |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | [(4aS,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-yl]-(3-chloro-1-benzothiophen-2-yl)methanone |
| SMILES | Cc1ccc2c(c1)[C@H]1C[NH+](C)CC[C@@H]1N2C(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C22H21ClN2OS/c1-13-7-8-17-15(11-13)16-12-24(2)10-9-18(16)25(17)22(26)21-20(23)14-5-3-4-6-19(14)27-21/h3-8,11,16,18H,9-10,12H2,1-2H3/p+1/t16-,18+/m1/s1 |
| InChIKey | AVSLSDOZPVTVDT-AEFFLSMTSA-O |
| XLogP | 3.89 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |