C14H12ClNO2S2 — CID 4963009
3-(3-chloro-1-benzothiophene-2-carbonyl)-4-ethyl-1,3-thiazolidin-2-one (PubChem CID 4963009) has the molecular formula C14H12ClNO2S2 and a molecular weight of 325.84 g/mol. Its IUPAC name is 3-(3-chloro-1-benzothiophene-2-carbonyl)-4-ethyl-1,3-thiazolidin-2-one.
| Compound Name | 3-(3-chloro-1-benzothiophene-2-carbonyl)-4-ethyl-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 4963009 |
| Molecular Formula | C14H12ClNO2S2 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | 3-(3-chloro-1-benzothiophene-2-carbonyl)-4-ethyl-1,3-thiazolidin-2-one |
| SMILES | CCC1CSC(=O)N1C(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C14H12ClNO2S2/c1-2-8-7-19-14(18)16(8)13(17)12-11(15)9-5-3-4-6-10(9)20-12/h3-6,8H,2,7H2,1H3 |
| InChIKey | ZCPISQLYWIAUAI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|