C16H16ClNO3S2 — CID 42936046
ethyl 4-(3-chloro-1-benzothiophene-2-carbonyl)thiomorpholine-3-carboxylate (PubChem CID 42936046) has the molecular formula C16H16ClNO3S2 and a molecular weight of 369.90 g/mol. Its IUPAC name is ethyl 4-(3-chloro-1-benzothiophene-2-carbonyl)thiomorpholine-3-carboxylate.
| Compound Name | ethyl 4-(3-chloro-1-benzothiophene-2-carbonyl)thiomorpholine-3-carboxylate |
|---|---|
| PubChem CID | 42936046 |
| Molecular Formula | C16H16ClNO3S2 |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | ethyl 4-(3-chloro-1-benzothiophene-2-carbonyl)thiomorpholine-3-carboxylate |
| SMILES | CCOC(=O)C1CSCCN1C(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C16H16ClNO3S2/c1-2-21-16(20)11-9-22-8-7-18(11)15(19)14-13(17)10-5-3-4-6-12(10)23-14/h3-6,11H,2,7-9H2,1H3 |
| InChIKey | QVIUMKANGPBINF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |