C16H21ClN2O5S2 — CID 18146581
ethyl 4-[2-chloro-5-(dimethylsulfamoyl)benzoyl]thiomorpholine-3-carboxylate (PubChem CID 18146581) has the molecular formula C16H21ClN2O5S2 and a molecular weight of 420.94 g/mol. Its IUPAC name is ethyl 4-[2-chloro-5-(dimethylsulfamoyl)benzoyl]thiomorpholine-3-carboxylate.
| Compound Name | ethyl 4-[2-chloro-5-(dimethylsulfamoyl)benzoyl]thiomorpholine-3-carboxylate |
|---|---|
| PubChem CID | 18146581 |
| Molecular Formula | C16H21ClN2O5S2 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | ethyl 4-[2-chloro-5-(dimethylsulfamoyl)benzoyl]thiomorpholine-3-carboxylate |
| SMILES | CCOC(=O)C1CSCCN1C(=O)c1cc(S(=O)(=O)N(C)C)ccc1Cl |
| InChI | InChI=1S/C16H21ClN2O5S2/c1-4-24-16(21)14-10-25-8-7-19(14)15(20)12-9-11(5-6-13(12)17)26(22,23)18(2)3/h5-6,9,14H,4,7-8,10H2,1-3H3 |
| InChIKey | URHXJXMOOQMFCQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |