C14H17ClN2O3S — CID 23343409
ethyl 4-[(4-chlorophenyl)carbamoyl]thiomorpholine-3-carboxylate (PubChem CID 23343409) has the molecular formula C14H17ClN2O3S and a molecular weight of 328.82 g/mol. Its IUPAC name is ethyl 4-[(4-chlorophenyl)carbamoyl]thiomorpholine-3-carboxylate.
| Compound Name | ethyl 4-[(4-chlorophenyl)carbamoyl]thiomorpholine-3-carboxylate |
|---|---|
| PubChem CID | 23343409 |
| Molecular Formula | C14H17ClN2O3S |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | ethyl 4-[(4-chlorophenyl)carbamoyl]thiomorpholine-3-carboxylate |
| SMILES | CCOC(=O)C1CSCCN1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H17ClN2O3S/c1-2-20-13(18)12-9-21-8-7-17(12)14(19)16-11-5-3-10(15)4-6-11/h3-6,12H,2,7-9H2,1H3,(H,16,19) |
| InChIKey | RRVCFIUXBVDCEW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |