C14H17FN2O3S — CID 61111666
ethyl 4-(5-amino-2-fluorobenzoyl)thiomorpholine-3-carboxylate (PubChem CID 61111666) has the molecular formula C14H17FN2O3S and a molecular weight of 312.37 g/mol. Its IUPAC name is ethyl 4-(5-amino-2-fluorobenzoyl)thiomorpholine-3-carboxylate.
| Compound Name | ethyl 4-(5-amino-2-fluorobenzoyl)thiomorpholine-3-carboxylate |
|---|---|
| PubChem CID | 61111666 |
| Molecular Formula | C14H17FN2O3S |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | ethyl 4-(5-amino-2-fluorobenzoyl)thiomorpholine-3-carboxylate |
| SMILES | CCOC(=O)C1CSCCN1C(=O)c1cc(N)ccc1F |
| InChI | InChI=1S/C14H17FN2O3S/c1-2-20-14(19)12-8-21-6-5-17(12)13(18)10-7-9(16)3-4-11(10)15/h3-4,7,12H,2,5-6,8,16H2,1H3 |
| InChIKey | XOMZYANIFUWHFF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|