C12H14ClNO4S — CID 106686228
ethyl 4-(2-chlorofuran-3-carbonyl)thiomorpholine-3-carboxylate (PubChem CID 106686228) has the molecular formula C12H14ClNO4S and a molecular weight of 303.77 g/mol. Its IUPAC name is ethyl 4-(2-chlorofuran-3-carbonyl)thiomorpholine-3-carboxylate.
| Compound Name | ethyl 4-(2-chlorofuran-3-carbonyl)thiomorpholine-3-carboxylate |
|---|---|
| PubChem CID | 106686228 |
| Molecular Formula | C12H14ClNO4S |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | ethyl 4-(2-chlorofuran-3-carbonyl)thiomorpholine-3-carboxylate |
| SMILES | CCOC(=O)C1CSCCN1C(=O)c1ccoc1Cl |
| InChI | InChI=1S/C12H14ClNO4S/c1-2-17-12(16)9-7-19-6-4-14(9)11(15)8-3-5-18-10(8)13/h3,5,9H,2,4,6-7H2,1H3 |
| InChIKey | BTTZVRGXVOFYSF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |