C13H10ClNO2S2 — CID 889632
3-chloro-N-[(3S)-2-oxothiolan-3-yl]-1-benzothiophene-2-carboxamide (PubChem CID 889632) has the molecular formula C13H10ClNO2S2 and a molecular weight of 311.81 g/mol. Its IUPAC name is 3-chloro-N-[(3S)-2-oxothiolan-3-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(3S)-2-oxothiolan-3-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 889632 |
| Molecular Formula | C13H10ClNO2S2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | 3-chloro-N-[(3S)-2-oxothiolan-3-yl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(N[C@H]1CCSC1=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C13H10ClNO2S2/c14-10-7-3-1-2-4-9(7)19-11(10)12(16)15-8-5-6-18-13(8)17/h1-4,8H,5-6H2,(H,15,16)/t8-/m0/s1 |
| InChIKey | FEZBSRYXIXYEHI-QMMMGPOBSA-N |
| XLogP | 3.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|