C22H25F3N2O3S — CID 69118500
6-methoxy-N,N-dimethyl-9-[3-(trifluoromethyl)phenyl]sulfonyl-1,2,3,4,4a,9a-hexahydrocarbazol-3-amine (PubChem CID 69118500) has the molecular formula C22H25F3N2O3S and a molecular weight of 454.51 g/mol. Its IUPAC name is 6-methoxy-N,N-dimethyl-9-[3-(trifluoromethyl)phenyl]sulfonyl-1,2,3,4,4a,9a-hexahydrocarbazol-3-amine.
| Compound Name | 6-methoxy-N,N-dimethyl-9-[3-(trifluoromethyl)phenyl]sulfonyl-1,2,3,4,4a,9a-hexahydrocarbazol-3-amine |
|---|---|
| PubChem CID | 69118500 |
| Molecular Formula | C22H25F3N2O3S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 6-methoxy-N,N-dimethyl-9-[3-(trifluoromethyl)phenyl]sulfonyl-1,2,3,4,4a,9a-hexahydrocarbazol-3-amine |
| SMILES | COc1ccc2c(c1)C1CC(N(C)C)CCC1N2S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H25F3N2O3S/c1-26(2)15-7-9-20-18(12-15)19-13-16(30-3)8-10-21(19)27(20)31(28,29)17-6-4-5-14(11-17)22(23,24)25/h4-6,8,10-11,13,15,18,20H,7,9,12H2,1-3H3 |
| InChIKey | SJXNDBDEOXAXBC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |