C17H18F3NO4S — CID 39795004
N-[2-(4-methoxyphenoxy)ethyl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 39795004) has the molecular formula C17H18F3NO4S and a molecular weight of 389.40 g/mol. Its IUPAC name is N-[2-(4-methoxyphenoxy)ethyl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-(4-methoxyphenoxy)ethyl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 39795004 |
| Molecular Formula | C17H18F3NO4S |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | N-[2-(4-methoxyphenoxy)ethyl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | COc1ccc(OCCN(C)S(=O)(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H18F3NO4S/c1-21(10-11-25-15-8-6-14(24-2)7-9-15)26(22,23)16-5-3-4-13(12-16)17(18,19)20/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | GLRXIUFMXLBOAE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |