C11H16ClF3N2O2S — CID 120718024
N-methyl-N-[2-(methylamino)ethyl]-3-(trifluoromethyl)benzenesulfonamide;hydrochloride (PubChem CID 120718024) has the molecular formula C11H16ClF3N2O2S and a molecular weight of 332.78 g/mol. Its IUPAC name is N-methyl-N-[2-(methylamino)ethyl]-3-(trifluoromethyl)benzenesulfonamide;hydrochloride.
| Compound Name | N-methyl-N-[2-(methylamino)ethyl]-3-(trifluoromethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120718024 |
| Molecular Formula | C11H16ClF3N2O2S |
| Molecular Weight | 332.78 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | N-methyl-N-[2-(methylamino)ethyl]-3-(trifluoromethyl)benzenesulfonamide;hydrochloride |
| SMILES | CNCCN(C)S(=O)(=O)c1cccc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C11H15F3N2O2S.ClH/c1-15-6-7-16(2)19(17,18)10-5-3-4-9(8-10)11(12,13)14;/h3-5,8,15H,6-7H2,1-2H3;1H |
| InChIKey | WSUILTLJMBMULH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.78 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |