C15H23ClF3N3O3S — CID 119433256
N-[3-(methylamino)propyl]-4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide;hydrochloride (PubChem CID 119433256) has the molecular formula C15H23ClF3N3O3S and a molecular weight of 417.88 g/mol. Its IUPAC name is N-[3-(methylamino)propyl]-4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide;hydrochloride.
| Compound Name | N-[3-(methylamino)propyl]-4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119433256 |
| Molecular Formula | C15H23ClF3N3O3S |
| Molecular Weight | 417.88 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | N-[3-(methylamino)propyl]-4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide;hydrochloride |
| SMILES | CNCCCNC(=O)CCCNS(=O)(=O)c1cccc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C15H22F3N3O3S.ClH/c1-19-8-4-9-20-14(22)7-3-10-21-25(23,24)13-6-2-5-12(11-13)15(16,17)18;/h2,5-6,11,19,21H,3-4,7-10H2,1H3,(H,20,22);1H |
| InChIKey | BATCAZLZKACDJM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.88 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|