C22H26BrNO3S — CID 71560607
(2S,3R,5aR,9aR)-3-bromo-5-(4-methylphenyl)sulfonyl-2-phenyl-3,4,5a,6,7,8,9,9a-octahydro-2H-benzo[b][1,4]oxazepine (PubChem CID 71560607) has the molecular formula C22H26BrNO3S and a molecular weight of 464.43 g/mol. Its IUPAC name is (2S,3R,5aR,9aR)-3-bromo-5-(4-methylphenyl)sulfonyl-2-phenyl-3,4,5a,6,7,8,9,9a-octahydro-2H-benzo[b][1,4]oxazepine.
| Compound Name | (2S,3R,5aR,9aR)-3-bromo-5-(4-methylphenyl)sulfonyl-2-phenyl-3,4,5a,6,7,8,9,9a-octahydro-2H-benzo[b][1,4]oxazepine |
|---|---|
| PubChem CID | 71560607 |
| Molecular Formula | C22H26BrNO3S |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | (2S,3R,5aR,9aR)-3-bromo-5-(4-methylphenyl)sulfonyl-2-phenyl-3,4,5a,6,7,8,9,9a-octahydro-2H-benzo[b][1,4]oxazepine |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H](Br)[C@H](c3ccccc3)O[C@@H]3CCCC[C@H]32)cc1 |
| InChI | InChI=1S/C22H26BrNO3S/c1-16-11-13-18(14-12-16)28(25,26)24-15-19(23)22(17-7-3-2-4-8-17)27-21-10-6-5-9-20(21)24/h2-4,7-8,11-14,19-22H,5-6,9-10,15H2,1H3/t19-,20-,21-,22+/m1/s1 |
| InChIKey | JSWROMULLJHVIK-YSFYHYPLSA-N |
| XLogP | 4.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|