C21H25NO4S — CID 101118689
(2R,4aR,5S,7aR)-2-methoxy-7-(4-methylphenyl)sulfonyl-5-phenyl-3,4,4a,5,6,7a-hexahydro-2H-pyrano[2,3-b]pyrrole (PubChem CID 101118689) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is (2R,4aR,5S,7aR)-2-methoxy-7-(4-methylphenyl)sulfonyl-5-phenyl-3,4,4a,5,6,7a-hexahydro-2H-pyrano[2,3-b]pyrrole.
| Compound Name | (2R,4aR,5S,7aR)-2-methoxy-7-(4-methylphenyl)sulfonyl-5-phenyl-3,4,4a,5,6,7a-hexahydro-2H-pyrano[2,3-b]pyrrole |
|---|---|
| PubChem CID | 101118689 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (2R,4aR,5S,7aR)-2-methoxy-7-(4-methylphenyl)sulfonyl-5-phenyl-3,4,4a,5,6,7a-hexahydro-2H-pyrano[2,3-b]pyrrole |
| SMILES | CO[C@H]1CC[C@@H]2[C@@H](c3ccccc3)CN(S(=O)(=O)c3ccc(C)cc3)[C@@H]2O1 |
| InChI | InChI=1S/C21H25NO4S/c1-15-8-10-17(11-9-15)27(23,24)22-14-19(16-6-4-3-5-7-16)18-12-13-20(25-2)26-21(18)22/h3-11,18-21H,12-14H2,1-2H3/t18-,19-,20-,21-/m1/s1 |
| InChIKey | HQUIKLIUIFZQPX-XRXFAXGQSA-N |
| XLogP | 3.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |