C14H17Br2NO2S — CID 124525352
(1S,3S,4R,6R)-3,4-dibromo-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.2.0]octane (PubChem CID 124525352) has the molecular formula C14H17Br2NO2S and a molecular weight of 423.17 g/mol. Its IUPAC name is (1S,3S,4R,6R)-3,4-dibromo-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.2.0]octane.
| Compound Name | (1S,3S,4R,6R)-3,4-dibromo-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.2.0]octane |
|---|---|
| PubChem CID | 124525352 |
| Molecular Formula | C14H17Br2NO2S |
| Molecular Weight | 423.17 g/mol |
| Exact Mass | 420.93 |
| IUPAC Name | (1S,3S,4R,6R)-3,4-dibromo-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.2.0]octane |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H]3C[C@H](Br)[C@H](Br)C[C@H]32)cc1 |
| InChI | InChI=1S/C14H17Br2NO2S/c1-9-2-4-11(5-3-9)20(18,19)17-8-10-6-12(15)13(16)7-14(10)17/h2-5,10,12-14H,6-8H2,1H3/t10-,12-,13+,14+/m0/s1 |
| InChIKey | LTYZJLPKSJCINJ-SCUASFONSA-N |
| XLogP | 3.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.17 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|