C13H15Br2NO2S — CID 124524844
(1S,3S,4S,6S)-7-(benzenesulfonyl)-3,4-dibromo-7-azabicyclo[4.2.0]octane (PubChem CID 124524844) has the molecular formula C13H15Br2NO2S and a molecular weight of 409.14 g/mol. Its IUPAC name is (1S,3S,4S,6S)-7-(benzenesulfonyl)-3,4-dibromo-7-azabicyclo[4.2.0]octane.
| Compound Name | (1S,3S,4S,6S)-7-(benzenesulfonyl)-3,4-dibromo-7-azabicyclo[4.2.0]octane |
|---|---|
| PubChem CID | 124524844 |
| Molecular Formula | C13H15Br2NO2S |
| Molecular Weight | 409.14 g/mol |
| Exact Mass | 406.92 |
| IUPAC Name | (1S,3S,4S,6S)-7-(benzenesulfonyl)-3,4-dibromo-7-azabicyclo[4.2.0]octane |
| SMILES | O=S(=O)(c1ccccc1)N1C[C@@H]2C[C@H](Br)[C@@H](Br)C[C@@H]21 |
| InChI | InChI=1S/C13H15Br2NO2S/c14-11-6-9-8-16(13(9)7-12(11)15)19(17,18)10-4-2-1-3-5-10/h1-5,9,11-13H,6-8H2/t9-,11-,12-,13-/m0/s1 |
| InChIKey | UVEUJHUBZDYONZ-BQUFFADESA-N |
| XLogP | 3.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.14 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|