C23H29NO2S — CID 11234463
1-(4-methylphenyl)sulfonyl-4-phenyl-1-azaspiro[4.6]undecane (PubChem CID 11234463) has the molecular formula C23H29NO2S and a molecular weight of 383.56 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-4-phenyl-1-azaspiro[4.6]undecane.
| Compound Name | 1-(4-methylphenyl)sulfonyl-4-phenyl-1-azaspiro[4.6]undecane |
|---|---|
| PubChem CID | 11234463 |
| Molecular Formula | C23H29NO2S |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-4-phenyl-1-azaspiro[4.6]undecane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(c3ccccc3)C23CCCCCC3)cc1 |
| InChI | InChI=1S/C23H29NO2S/c1-19-11-13-21(14-12-19)27(25,26)24-18-15-22(20-9-5-4-6-10-20)23(24)16-7-2-3-8-17-23/h4-6,9-14,22H,2-3,7-8,15-18H2,1H3 |
| InChIKey | WFQREEDPVZRTEY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |