C21H29NO4S — CID 102215260
[(E)-4-[(5S,6S)-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decan-6-yl]but-3-en-2-yl] formate (PubChem CID 102215260) has the molecular formula C21H29NO4S and a molecular weight of 391.53 g/mol. Its IUPAC name is [(E)-4-[(5S,6S)-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decan-6-yl]but-3-en-2-yl] formate.
| Compound Name | [(E)-4-[(5S,6S)-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decan-6-yl]but-3-en-2-yl] formate |
|---|---|
| PubChem CID | 102215260 |
| Molecular Formula | C21H29NO4S |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | [(E)-4-[(5S,6S)-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decan-6-yl]but-3-en-2-yl] formate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@]23CCCC[C@H]3/C=C/C(C)OC=O)cc1 |
| InChI | InChI=1S/C21H29NO4S/c1-17-7-11-20(12-8-17)27(24,25)22-15-5-14-21(22)13-4-3-6-19(21)10-9-18(2)26-16-23/h7-12,16,18-19H,3-6,13-15H2,1-2H3/b10-9+/t18?,19-,21-/m0/s1 |
| InChIKey | HSNBDHHGZCGTAD-ZZENUWJUSA-N |
| XLogP | 3.83 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|