C15H20INO2S — CID 74078359
3a-iodo-1-(4-methylphenyl)sulfonyl-3,4,5,6,7,7a-hexahydro-2H-indole (PubChem CID 74078359) has the molecular formula C15H20INO2S and a molecular weight of 405.30 g/mol. Its IUPAC name is 3a-iodo-1-(4-methylphenyl)sulfonyl-3,4,5,6,7,7a-hexahydro-2H-indole.
| Compound Name | 3a-iodo-1-(4-methylphenyl)sulfonyl-3,4,5,6,7,7a-hexahydro-2H-indole |
|---|---|
| PubChem CID | 74078359 |
| Molecular Formula | C15H20INO2S |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | 3a-iodo-1-(4-methylphenyl)sulfonyl-3,4,5,6,7,7a-hexahydro-2H-indole |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC3(I)CCCCC23)cc1 |
| InChI | InChI=1S/C15H20INO2S/c1-12-5-7-13(8-6-12)20(18,19)17-11-10-15(16)9-3-2-4-14(15)17/h5-8,14H,2-4,9-11H2,1H3 |
| InChIKey | XQZGCGITIZFXQV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|