C17H25NO3S — CID 127053517
(3R,4S)-3-methyl-1-(4-methylphenyl)sulfonyl-3-propan-2-ylpiperidine-4-carbaldehyde (PubChem CID 127053517) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is (3R,4S)-3-methyl-1-(4-methylphenyl)sulfonyl-3-propan-2-ylpiperidine-4-carbaldehyde.
| Compound Name | (3R,4S)-3-methyl-1-(4-methylphenyl)sulfonyl-3-propan-2-ylpiperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 127053517 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (3R,4S)-3-methyl-1-(4-methylphenyl)sulfonyl-3-propan-2-ylpiperidine-4-carbaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@H](C=O)[C@@](C)(C(C)C)C2)cc1 |
| InChI | InChI=1S/C17H25NO3S/c1-13(2)17(4)12-18(10-9-15(17)11-19)22(20,21)16-7-5-14(3)6-8-16/h5-8,11,13,15H,9-10,12H2,1-4H3/t15-,17-/m1/s1 |
| InChIKey | UJFLKVVSLZSRSP-NVXWUHKLSA-N |
| XLogP | 2.87 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|