C18H27NO2SSi — CID 102078814
trimethyl-[(Z)-2-[3-(4-methylphenyl)sulfonyl-3-azabicyclo[4.1.0]heptan-1-yl]ethenyl]silane (PubChem CID 102078814) has the molecular formula C18H27NO2SSi and a molecular weight of 349.57 g/mol. Its IUPAC name is trimethyl-[(Z)-2-[3-(4-methylphenyl)sulfonyl-3-azabicyclo[4.1.0]heptan-1-yl]ethenyl]silane.
| Compound Name | trimethyl-[(Z)-2-[3-(4-methylphenyl)sulfonyl-3-azabicyclo[4.1.0]heptan-1-yl]ethenyl]silane |
|---|---|
| PubChem CID | 102078814 |
| Molecular Formula | C18H27NO2SSi |
| Molecular Weight | 349.57 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | trimethyl-[(Z)-2-[3-(4-methylphenyl)sulfonyl-3-azabicyclo[4.1.0]heptan-1-yl]ethenyl]silane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC3CC3(/C=C\[Si](C)(C)C)C2)cc1 |
| InChI | InChI=1S/C18H27NO2SSi/c1-15-5-7-17(8-6-15)22(20,21)19-11-9-16-13-18(16,14-19)10-12-23(2,3)4/h5-8,10,12,16H,9,11,13-14H2,1-4H3/b12-10- |
| InChIKey | NLRFUEFEYREQDL-BENRWUELSA-N |
| XLogP | 3.83 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|