C20H31NO3SSi — CID 102078815
2-[3-(4-methylphenyl)sulfonyl-1-[(Z)-2-trimethylsilylethenyl]-3-azabicyclo[3.1.0]hexan-6-yl]propan-2-ol (PubChem CID 102078815) has the molecular formula C20H31NO3SSi and a molecular weight of 393.63 g/mol. Its IUPAC name is 2-[3-(4-methylphenyl)sulfonyl-1-[(Z)-2-trimethylsilylethenyl]-3-azabicyclo[3.1.0]hexan-6-yl]propan-2-ol.
| Compound Name | 2-[3-(4-methylphenyl)sulfonyl-1-[(Z)-2-trimethylsilylethenyl]-3-azabicyclo[3.1.0]hexan-6-yl]propan-2-ol |
|---|---|
| PubChem CID | 102078815 |
| Molecular Formula | C20H31NO3SSi |
| Molecular Weight | 393.63 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 2-[3-(4-methylphenyl)sulfonyl-1-[(Z)-2-trimethylsilylethenyl]-3-azabicyclo[3.1.0]hexan-6-yl]propan-2-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3C(C(C)(C)O)C3(/C=C\[Si](C)(C)C)C2)cc1 |
| InChI | InChI=1S/C20H31NO3SSi/c1-15-7-9-16(10-8-15)25(23,24)21-13-17-18(19(2,3)22)20(17,14-21)11-12-26(4,5)6/h7-12,17-18,22H,13-14H2,1-6H3/b12-11- |
| InChIKey | ORXDNQUYYLREGU-QXMHVHEDSA-N |
| XLogP | 3.44 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.63 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|