C19H28INO2S — CID 122396158
2-(cyclohexylmethyl)-2-(iodomethyl)-1-(4-methylphenyl)sulfonylpyrrolidine (PubChem CID 122396158) has the molecular formula C19H28INO2S and a molecular weight of 461.41 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-2-(iodomethyl)-1-(4-methylphenyl)sulfonylpyrrolidine.
| Compound Name | 2-(cyclohexylmethyl)-2-(iodomethyl)-1-(4-methylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 122396158 |
| Molecular Formula | C19H28INO2S |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 2-(cyclohexylmethyl)-2-(iodomethyl)-1-(4-methylphenyl)sulfonylpyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC2(CI)CC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H28INO2S/c1-16-8-10-18(11-9-16)24(22,23)21-13-5-12-19(21,15-20)14-17-6-3-2-4-7-17/h8-11,17H,2-7,12-15H2,1H3 |
| InChIKey | KWBGLTPWODNMRQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|