C20H27NO4S — CID 102215259
[(E)-4-[1-(4-methylphenyl)sulfonyl-1-azaspiro[4.4]nonan-9-yl]but-3-en-2-yl] formate (PubChem CID 102215259) has the molecular formula C20H27NO4S and a molecular weight of 377.51 g/mol. Its IUPAC name is [(E)-4-[1-(4-methylphenyl)sulfonyl-1-azaspiro[4.4]nonan-9-yl]but-3-en-2-yl] formate.
| Compound Name | [(E)-4-[1-(4-methylphenyl)sulfonyl-1-azaspiro[4.4]nonan-9-yl]but-3-en-2-yl] formate |
|---|---|
| PubChem CID | 102215259 |
| Molecular Formula | C20H27NO4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | [(E)-4-[1-(4-methylphenyl)sulfonyl-1-azaspiro[4.4]nonan-9-yl]but-3-en-2-yl] formate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC23CCCC3/C=C/C(C)OC=O)cc1 |
| InChI | InChI=1S/C20H27NO4S/c1-16-6-10-19(11-7-16)26(23,24)21-14-4-13-20(21)12-3-5-18(20)9-8-17(2)25-15-22/h6-11,15,17-18H,3-5,12-14H2,1-2H3/b9-8+ |
| InChIKey | CHBNKHPQLICHJP-CMDGGOBGSA-N |
| XLogP | 3.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|