C21H23NO3S — CID 155935594
(5R)-2-methyl-6-(4-methylphenyl)sulfonyl-3-phenyl-1-oxa-6-azaspiro[4.4]non-2-ene (PubChem CID 155935594) has the molecular formula C21H23NO3S and a molecular weight of 369.49 g/mol. Its IUPAC name is (5R)-2-methyl-6-(4-methylphenyl)sulfonyl-3-phenyl-1-oxa-6-azaspiro[4.4]non-2-ene.
| Compound Name | (5R)-2-methyl-6-(4-methylphenyl)sulfonyl-3-phenyl-1-oxa-6-azaspiro[4.4]non-2-ene |
|---|---|
| PubChem CID | 155935594 |
| Molecular Formula | C21H23NO3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | (5R)-2-methyl-6-(4-methylphenyl)sulfonyl-3-phenyl-1-oxa-6-azaspiro[4.4]non-2-ene |
| SMILES | CC1=C(c2ccccc2)C[C@@]2(CCCN2S(=O)(=O)c2ccc(C)cc2)O1 |
| InChI | InChI=1S/C21H23NO3S/c1-16-9-11-19(12-10-16)26(23,24)22-14-6-13-21(22)15-20(17(2)25-21)18-7-4-3-5-8-18/h3-5,7-12H,6,13-15H2,1-2H3/t21-/m1/s1 |
| InChIKey | VGJSWWAVKBDPRA-OAQYLSRUSA-N |
| XLogP | 4.33 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |