C16H16N2O2S — CID 34885089
1-(4-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole (PubChem CID 34885089) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole.
| Compound Name | 1-(4-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 34885089 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C16H16N2O2S/c1-13-7-9-15(10-8-13)21(19,20)18-12-11-17-16(18)14-5-3-2-4-6-14/h2-10H,11-12H2,1H3 |
| InChIKey | SMBZUEGQNDNVDM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |