C20H24N2O3S — CID 35203154
1-(4-butoxy-3-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole (PubChem CID 35203154) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 1-(4-butoxy-3-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole.
| Compound Name | 1-(4-butoxy-3-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 35203154 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-(4-butoxy-3-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2CCN=C2c2ccccc2)cc1C |
| InChI | InChI=1S/C20H24N2O3S/c1-3-4-14-25-19-11-10-18(15-16(19)2)26(23,24)22-13-12-21-20(22)17-8-6-5-7-9-17/h5-11,15H,3-4,12-14H2,1-2H3 |
| InChIKey | OHODWFFQQNYIPV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|