C22H25NO3S — CID 101161455
(1S)-2-(4-methylphenyl)sulfonyl-1-phenyl-2-azaspiro[3.6]decan-3-one (PubChem CID 101161455) has the molecular formula C22H25NO3S and a molecular weight of 383.51 g/mol. Its IUPAC name is (1S)-2-(4-methylphenyl)sulfonyl-1-phenyl-2-azaspiro[3.6]decan-3-one.
| Compound Name | (1S)-2-(4-methylphenyl)sulfonyl-1-phenyl-2-azaspiro[3.6]decan-3-one |
|---|---|
| PubChem CID | 101161455 |
| Molecular Formula | C22H25NO3S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | (1S)-2-(4-methylphenyl)sulfonyl-1-phenyl-2-azaspiro[3.6]decan-3-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)C3(CCCCCC3)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H25NO3S/c1-17-11-13-19(14-12-17)27(25,26)23-20(18-9-5-4-6-10-18)22(21(23)24)15-7-2-3-8-16-22/h4-6,9-14,20H,2-3,7-8,15-16H2,1H3/t20-/m0/s1 |
| InChIKey | UEDHVUNQDVZOGO-FQEVSTJZSA-N |
| XLogP | 4.61 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |