C21H21NO3S — CID 11405951
(5S,10S)-9-(4-methylphenyl)sulfonyl-10-phenyl-1-oxa-9-azaspiro[4.5]deca-3,6-diene (PubChem CID 11405951) has the molecular formula C21H21NO3S and a molecular weight of 367.47 g/mol. Its IUPAC name is (5S,10S)-9-(4-methylphenyl)sulfonyl-10-phenyl-1-oxa-9-azaspiro[4.5]deca-3,6-diene.
| Compound Name | (5S,10S)-9-(4-methylphenyl)sulfonyl-10-phenyl-1-oxa-9-azaspiro[4.5]deca-3,6-diene |
|---|---|
| PubChem CID | 11405951 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (5S,10S)-9-(4-methylphenyl)sulfonyl-10-phenyl-1-oxa-9-azaspiro[4.5]deca-3,6-diene |
| SMILES | Cc1ccc(S(=O)(=O)N2CC=C[C@]3(C=CCO3)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C21H21NO3S/c1-17-9-11-19(12-10-17)26(23,24)22-15-5-13-21(14-6-16-25-21)20(22)18-7-3-2-4-8-18/h2-14,20H,15-16H2,1H3/t20-,21-/m0/s1 |
| InChIKey | LIFRQZCUXBBQSD-SFTDATJTSA-N |
| XLogP | 3.62 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|