C18H17NO3S — CID 90424128
1-(4-methylphenyl)sulfonyl-2-phenyl-2,6-dihydropyridin-3-one (PubChem CID 90424128) has the molecular formula C18H17NO3S and a molecular weight of 327.41 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-2-phenyl-2,6-dihydropyridin-3-one.
| Compound Name | 1-(4-methylphenyl)sulfonyl-2-phenyl-2,6-dihydropyridin-3-one |
|---|---|
| PubChem CID | 90424128 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-2-phenyl-2,6-dihydropyridin-3-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC=CC(=O)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C18H17NO3S/c1-14-9-11-16(12-10-14)23(21,22)19-13-5-8-17(20)18(19)15-6-3-2-4-7-15/h2-12,18H,13H2,1H3 |
| InChIKey | COSRZEIZZQGQDV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |