C29H25NO2SSe2 — CID 122400645
1-(4-methylphenyl)sulfonyl-2-phenyl-3,4-bis(phenylselanyl)-2,5-dihydropyrrole (PubChem CID 122400645) has the molecular formula C29H25NO2SSe2 and a molecular weight of 609.51 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-2-phenyl-3,4-bis(phenylselanyl)-2,5-dihydropyrrole.
| Compound Name | 1-(4-methylphenyl)sulfonyl-2-phenyl-3,4-bis(phenylselanyl)-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 122400645 |
| Molecular Formula | C29H25NO2SSe2 |
| Molecular Weight | 609.51 g/mol |
| Exact Mass | 610.99 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-2-phenyl-3,4-bis(phenylselanyl)-2,5-dihydropyrrole |
| SMILES | Cc1ccc(S(=O)(=O)N2CC([Se]c3ccccc3)=C([Se]c3ccccc3)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C29H25NO2SSe2/c1-22-17-19-24(20-18-22)33(31,32)30-21-27(34-25-13-7-3-8-14-25)29(35-26-15-9-4-10-16-26)28(30)23-11-5-2-6-12-23/h2-20,28H,21H2,1H3 |
| InChIKey | YGHZITUWCMNENE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|