C27H30N2O4S2 — CID 134851505
1,4-bis-(4-methylphenyl)sulfonyl-2-phenyl-3-propan-2-ylidenepiperazine (PubChem CID 134851505) has the molecular formula C27H30N2O4S2 and a molecular weight of 510.68 g/mol. Its IUPAC name is 1,4-bis-(4-methylphenyl)sulfonyl-2-phenyl-3-propan-2-ylidenepiperazine.
| Compound Name | 1,4-bis-(4-methylphenyl)sulfonyl-2-phenyl-3-propan-2-ylidenepiperazine |
|---|---|
| PubChem CID | 134851505 |
| Molecular Formula | C27H30N2O4S2 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 1,4-bis-(4-methylphenyl)sulfonyl-2-phenyl-3-propan-2-ylidenepiperazine |
| SMILES | CC(C)=C1C(c2ccccc2)N(S(=O)(=O)c2ccc(C)cc2)CCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H30N2O4S2/c1-20(2)26-27(23-8-6-5-7-9-23)29(35(32,33)25-16-12-22(4)13-17-25)19-18-28(26)34(30,31)24-14-10-21(3)11-15-24/h5-17,27H,18-19H2,1-4H3 |
| InChIKey | DGTBSNAGXHYOTO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |