C21H17NO3S — CID 132940992
2-(4-methylphenyl)sulfonyl-3-phenyl-3H-isoindol-1-one (PubChem CID 132940992) has the molecular formula C21H17NO3S and a molecular weight of 363.44 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-3-phenyl-3H-isoindol-1-one.
| Compound Name | 2-(4-methylphenyl)sulfonyl-3-phenyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 132940992 |
| Molecular Formula | C21H17NO3S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-3-phenyl-3H-isoindol-1-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)c3ccccc3C2c2ccccc2)cc1 |
| InChI | InChI=1S/C21H17NO3S/c1-15-11-13-17(14-12-15)26(24,25)22-20(16-7-3-2-4-8-16)18-9-5-6-10-19(18)21(22)23/h2-14,20H,1H3 |
| InChIKey | CKYLIGUJCINVAU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |