C22H17BrN2O5S — CID 122205463
(3R,4S)-3-(2-bromophenyl)-2-(4-methylphenyl)sulfonyl-4-nitro-3,4-dihydroisoquinolin-1-one (PubChem CID 122205463) has the molecular formula C22H17BrN2O5S and a molecular weight of 501.36 g/mol. Its IUPAC name is (3R,4S)-3-(2-bromophenyl)-2-(4-methylphenyl)sulfonyl-4-nitro-3,4-dihydroisoquinolin-1-one.
| Compound Name | (3R,4S)-3-(2-bromophenyl)-2-(4-methylphenyl)sulfonyl-4-nitro-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 122205463 |
| Molecular Formula | C22H17BrN2O5S |
| Molecular Weight | 501.36 g/mol |
| Exact Mass | 500.00 |
| IUPAC Name | (3R,4S)-3-(2-bromophenyl)-2-(4-methylphenyl)sulfonyl-4-nitro-3,4-dihydroisoquinolin-1-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)c3ccccc3[C@H]([N+](=O)[O-])[C@H]2c2ccccc2Br)cc1 |
| InChI | InChI=1S/C22H17BrN2O5S/c1-14-10-12-15(13-11-14)31(29,30)24-20(18-8-4-5-9-19(18)23)21(25(27)28)16-6-2-3-7-17(16)22(24)26/h2-13,20-21H,1H3/t20-,21+/m1/s1 |
| InChIKey | YHWQZWUQDOEGAS-RTWAWAEBSA-N |
| XLogP | 4.66 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|