C23H25Cl2NO3S2 — CID 134919162
(4R)-3,3-dichloro-5-cyclohexylsulfanyl-1-(4-methylphenyl)sulfonyl-4-phenylpyrrolidin-2-one (PubChem CID 134919162) has the molecular formula C23H25Cl2NO3S2 and a molecular weight of 498.50 g/mol. Its IUPAC name is (4R)-3,3-dichloro-5-cyclohexylsulfanyl-1-(4-methylphenyl)sulfonyl-4-phenylpyrrolidin-2-one.
| Compound Name | (4R)-3,3-dichloro-5-cyclohexylsulfanyl-1-(4-methylphenyl)sulfonyl-4-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 134919162 |
| Molecular Formula | C23H25Cl2NO3S2 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | (4R)-3,3-dichloro-5-cyclohexylsulfanyl-1-(4-methylphenyl)sulfonyl-4-phenylpyrrolidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)C(Cl)(Cl)[C@H](c3ccccc3)C2SC2CCCCC2)cc1 |
| InChI | InChI=1S/C23H25Cl2NO3S2/c1-16-12-14-19(15-13-16)31(28,29)26-21(30-18-10-6-3-7-11-18)20(23(24,25)22(26)27)17-8-4-2-5-9-17/h2,4-5,8-9,12-15,18,20-21H,3,6-7,10-11H2,1H3/t20-,21?/m1/s1 |
| InChIKey | IWMZHMQXAWIKBV-VQCQRNETSA-N |
| XLogP | 5.88 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|