C23H19Cl2NO3S2 — CID 102209180
(4R,5R)-3,3-dichloro-1-(4-methylphenyl)sulfonyl-4-phenyl-5-phenylsulfanylpyrrolidin-2-one (PubChem CID 102209180) has the molecular formula C23H19Cl2NO3S2 and a molecular weight of 492.45 g/mol. Its IUPAC name is (4R,5R)-3,3-dichloro-1-(4-methylphenyl)sulfonyl-4-phenyl-5-phenylsulfanylpyrrolidin-2-one.
| Compound Name | (4R,5R)-3,3-dichloro-1-(4-methylphenyl)sulfonyl-4-phenyl-5-phenylsulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 102209180 |
| Molecular Formula | C23H19Cl2NO3S2 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 491.02 |
| IUPAC Name | (4R,5R)-3,3-dichloro-1-(4-methylphenyl)sulfonyl-4-phenyl-5-phenylsulfanylpyrrolidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)C(Cl)(Cl)[C@H](c3ccccc3)[C@H]2Sc2ccccc2)cc1 |
| InChI | InChI=1S/C23H19Cl2NO3S2/c1-16-12-14-19(15-13-16)31(28,29)26-21(30-18-10-6-3-7-11-18)20(23(24,25)22(26)27)17-8-4-2-5-9-17/h2-15,20-21H,1H3/t20-,21-/m1/s1 |
| InChIKey | GPIAZOFNAZDNTP-NHCUHLMSSA-N |
| XLogP | 5.60 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|