C23H18Cl3NO3S2 — CID 134919732
(NZ)-N-[(4R,5R)-3,3-dichloro-5-(4-chlorophenyl)sulfanyl-4-phenyloxolan-2-ylidene]-4-methylbenzenesulfonamide (PubChem CID 134919732) has the molecular formula C23H18Cl3NO3S2 and a molecular weight of 526.89 g/mol. Its IUPAC name is (NZ)-N-[(4R,5R)-3,3-dichloro-5-(4-chlorophenyl)sulfanyl-4-phenyloxolan-2-ylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NZ)-N-[(4R,5R)-3,3-dichloro-5-(4-chlorophenyl)sulfanyl-4-phenyloxolan-2-ylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134919732 |
| Molecular Formula | C23H18Cl3NO3S2 |
| Molecular Weight | 526.89 g/mol |
| Exact Mass | 524.98 |
| IUPAC Name | (NZ)-N-[(4R,5R)-3,3-dichloro-5-(4-chlorophenyl)sulfanyl-4-phenyloxolan-2-ylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C2\O[C@H](Sc3ccc(Cl)cc3)[C@@H](c3ccccc3)C2(Cl)Cl)cc1 |
| InChI | InChI=1S/C23H18Cl3NO3S2/c1-15-7-13-19(14-8-15)32(28,29)27-22-23(25,26)20(16-5-3-2-4-6-16)21(30-22)31-18-11-9-17(24)10-12-18/h2-14,20-21H,1H3/b27-22-/t20-,21-/m1/s1 |
| InChIKey | KVESWNBMNZLYJO-YYXDIRPJSA-N |
| XLogP | 6.84 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.89 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|