C23H24ClNO5S — CID 46914420
pentyl (4Z)-4-(4-chlorophenyl)sulfonylimino-2-methyl-5-phenylfuran-3-carboxylate (PubChem CID 46914420) has the molecular formula C23H24ClNO5S and a molecular weight of 461.97 g/mol. Its IUPAC name is pentyl (4Z)-4-(4-chlorophenyl)sulfonylimino-2-methyl-5-phenylfuran-3-carboxylate.
| Compound Name | pentyl (4Z)-4-(4-chlorophenyl)sulfonylimino-2-methyl-5-phenylfuran-3-carboxylate |
|---|---|
| PubChem CID | 46914420 |
| Molecular Formula | C23H24ClNO5S |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | pentyl (4Z)-4-(4-chlorophenyl)sulfonylimino-2-methyl-5-phenylfuran-3-carboxylate |
| SMILES | CCCCCOC(=O)C1=C(C)OC(c2ccccc2)/C1=N\S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H24ClNO5S/c1-3-4-8-15-29-23(26)20-16(2)30-22(17-9-6-5-7-10-17)21(20)25-31(27,28)19-13-11-18(24)12-14-19/h5-7,9-14,22H,3-4,8,15H2,1-2H3/b25-21- |
| InChIKey | PISQYYOAIVQTKI-DAFNUICNSA-N |
| XLogP | 5.25 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|