C17H17ClN2O3S — CID 7214268
4-chloro-N-[(4S,5R)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-ylidene]benzenesulfonamide (PubChem CID 7214268) has the molecular formula C17H17ClN2O3S and a molecular weight of 364.85 g/mol. Its IUPAC name is 4-chloro-N-[(4S,5R)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(4S,5R)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 7214268 |
| Molecular Formula | C17H17ClN2O3S |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 4-chloro-N-[(4S,5R)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-ylidene]benzenesulfonamide |
| SMILES | C[C@H]1[C@@H](c2ccccc2)OC(=NS(=O)(=O)c2ccc(Cl)cc2)N1C |
| InChI | InChI=1S/C17H17ClN2O3S/c1-12-16(13-6-4-3-5-7-13)23-17(20(12)2)19-24(21,22)15-10-8-14(18)9-11-15/h3-12,16H,1-2H3/t12-,16-/m0/s1 |
| InChIKey | ARQAYEHJJBQGSN-LRDDRELGSA-N |
| XLogP | 3.48 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|