C16H10Cl3NO3S — CID 134612923
4-chloro-N-(2,3-dichloro-4-oxo-2,3-dihydronaphthalen-1-ylidene)benzenesulfonamide (PubChem CID 134612923) has the molecular formula C16H10Cl3NO3S and a molecular weight of 402.69 g/mol. Its IUPAC name is 4-chloro-N-(2,3-dichloro-4-oxo-2,3-dihydronaphthalen-1-ylidene)benzenesulfonamide.
| Compound Name | 4-chloro-N-(2,3-dichloro-4-oxo-2,3-dihydronaphthalen-1-ylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 134612923 |
| Molecular Formula | C16H10Cl3NO3S |
| Molecular Weight | 402.69 g/mol |
| Exact Mass | 400.94 |
| IUPAC Name | 4-chloro-N-(2,3-dichloro-4-oxo-2,3-dihydronaphthalen-1-ylidene)benzenesulfonamide |
| SMILES | O=C1c2ccccc2C(=NS(=O)(=O)c2ccc(Cl)cc2)C(Cl)C1Cl |
| InChI | InChI=1S/C16H10Cl3NO3S/c17-9-5-7-10(8-6-9)24(22,23)20-15-11-3-1-2-4-12(11)16(21)14(19)13(15)18/h1-8,13-14H |
| InChIKey | XJFYJCARROFLMJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.69 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|