C14H10Cl3NO3S — CID 5118131
4-chloro-N-(3,5-dichloro-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)benzenesulfonamide (PubChem CID 5118131) has the molecular formula C14H10Cl3NO3S and a molecular weight of 378.66 g/mol. Its IUPAC name is 4-chloro-N-(3,5-dichloro-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)benzenesulfonamide.
| Compound Name | 4-chloro-N-(3,5-dichloro-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 5118131 |
| Molecular Formula | C14H10Cl3NO3S |
| Molecular Weight | 378.66 g/mol |
| Exact Mass | 376.94 |
| IUPAC Name | 4-chloro-N-(3,5-dichloro-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)benzenesulfonamide |
| SMILES | CC1=C(Cl)C(=O)C(Cl)=C(C)C1=NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H10Cl3NO3S/c1-7-11(16)14(19)12(17)8(2)13(7)18-22(20,21)10-5-3-9(15)4-6-10/h3-6H,1-2H3 |
| InChIKey | FDDFSUDTGNOLEH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.66 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|