C15H13ClNO4S- — CID 4740399
[6-(4-chlorophenyl)sulfonyliminocyclohexa-2,4-dien-1-ylidene]-ethoxymethanolate (PubChem CID 4740399) has the molecular formula C15H13ClNO4S- and a molecular weight of 338.79 g/mol. Its IUPAC name is [6-(4-chlorophenyl)sulfonyliminocyclohexa-2,4-dien-1-ylidene]-ethoxymethanolate.
| Compound Name | [6-(4-chlorophenyl)sulfonyliminocyclohexa-2,4-dien-1-ylidene]-ethoxymethanolate |
|---|---|
| PubChem CID | 4740399 |
| Molecular Formula | C15H13ClNO4S- |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | [6-(4-chlorophenyl)sulfonyliminocyclohexa-2,4-dien-1-ylidene]-ethoxymethanolate |
| SMILES | CCOC([O-])=C1C=CC=CC1=NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H14ClNO4S/c1-2-21-15(18)13-5-3-4-6-14(13)17-22(19,20)12-9-7-11(16)8-10-12/h3-10,18H,2H2,1H3/p-1 |
| InChIKey | LWXOOIBPYHMYLZ-UHFFFAOYSA-M |
| XLogP | 2.20 |
| TPSA | 78.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|