C8H9NaO2 — CID 23697899
sodium cyclopenta-2,4-dien-1-ylidene(ethoxy)methanolate (PubChem CID 23697899) has the molecular formula C8H9NaO2 and a molecular weight of 160.15 g/mol. Its IUPAC name is sodium cyclopenta-2,4-dien-1-ylidene(ethoxy)methanolate.
| Compound Name | sodium cyclopenta-2,4-dien-1-ylidene(ethoxy)methanolate |
|---|---|
| PubChem CID | 23697899 |
| Molecular Formula | C8H9NaO2 |
| Molecular Weight | 160.15 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | sodium cyclopenta-2,4-dien-1-ylidene(ethoxy)methanolate |
| SMILES | CCOC([O-])=C1C=CC=C1.[Na+] |
| InChI | InChI=1S/C8H10O2.Na/c1-2-10-8(9)7-5-3-4-6-7;/h3-6,9H,2H2,1H3;/q;+1/p-1 |
| InChIKey | FZAWZZHDPQLCKJ-UHFFFAOYSA-M |
| XLogP | -2.28 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.15 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|